C16H24O — CID 115791341
1-(2,3-dihydro-1H-inden-5-yl)-4,4-dimethylpentan-1-ol (PubChem CID 115791341) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-4,4-dimethylpentan-1-ol.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 115791341 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)CCC(O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H24O/c1-16(2,3)10-9-15(17)14-8-7-12-5-4-6-13(12)11-14/h7-8,11,15,17H,4-6,9-10H2,1-3H3 |
| InChIKey | DBVSXIZLMCBKHL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |