C17H22O — CID 114190708
1-(2,3-dihydro-1H-inden-5-yl)-5,5-dimethylhex-3-yn-1-ol (PubChem CID 114190708) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-5,5-dimethylhex-3-yn-1-ol.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-5,5-dimethylhex-3-yn-1-ol |
|---|---|
| PubChem CID | 114190708 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-5,5-dimethylhex-3-yn-1-ol |
| SMILES | CC(C)(C)C#CCC(O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H22O/c1-17(2,3)11-5-8-16(18)15-10-9-13-6-4-7-14(13)12-15/h9-10,12,16,18H,4,6-8H2,1-3H3 |
| InChIKey | PRKHSYLCYQTTGZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|