About 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid
3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid (PubChem CID 82366719) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid.
Analyze 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid?
The IUPAC name of 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid (CID 82366719) is 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid.
What is the SMILES notation for 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid?
The canonical SMILES for 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid is O=C(O)CC(O)c1ccc2c(c1)CCCC2.
What is the InChIKey of 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid?
The InChIKey is WTLAMCQWOPAGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c14-12(8-13(15)16)11-6-5-9-3-1-2-4-10(9)7-11/h5-7,12,14H,1-4,8H2,(H,15,16).
What are the key properties of 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid?
3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid has a molecular weight of 220.27 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3-(5,6,7,8-tetrahydronaphthalen-2-yl)propanoic acid is sourced from PubChem (CID 82366719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).