C13H15NaO3 — CID 23703653
sodium 4-(2,3-dihydro-1H-inden-5-yl)-4-hydroxybutanoate (PubChem CID 23703653) has the molecular formula C13H15NaO3 and a molecular weight of 242.25 g/mol. Its IUPAC name is sodium 4-(2,3-dihydro-1H-inden-5-yl)-4-hydroxybutanoate.
| Compound Name | sodium 4-(2,3-dihydro-1H-inden-5-yl)-4-hydroxybutanoate |
|---|---|
| PubChem CID | 23703653 |
| Molecular Formula | C13H15NaO3 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | sodium 4-(2,3-dihydro-1H-inden-5-yl)-4-hydroxybutanoate |
| SMILES | O=C([O-])CCC(O)c1ccc2c(c1)CCC2.[Na+] |
| InChI | InChI=1S/C13H16O3.Na/c14-12(6-7-13(15)16)11-5-4-9-2-1-3-10(9)8-11;/h4-5,8,12,14H,1-3,6-7H2,(H,15,16);/q;+1/p-1 |
| InChIKey | PUMPXLOMZNCQOD-UHFFFAOYSA-M |
| XLogP | -2.26 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |