C16H15FO — CID 61100715
2,3-dihydro-1H-inden-5-yl-(4-fluorophenyl)methanol (PubChem CID 61100715) has the molecular formula C16H15FO and a molecular weight of 242.29 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl-(4-fluorophenyl)methanol.
| Compound Name | 2,3-dihydro-1H-inden-5-yl-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 61100715 |
| Molecular Formula | C16H15FO |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl-(4-fluorophenyl)methanol |
| SMILES | OC(c1ccc(F)cc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H15FO/c17-15-8-6-12(7-9-15)16(18)14-5-4-11-2-1-3-13(11)10-14/h4-10,16,18H,1-3H2 |
| InChIKey | AKASQGWIFKWUDH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |