C16H15IO — CID 61088523
2,3-dihydro-1H-inden-5-yl-(3-iodophenyl)methanol (PubChem CID 61088523) has the molecular formula C16H15IO and a molecular weight of 350.20 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl-(3-iodophenyl)methanol.
| Compound Name | 2,3-dihydro-1H-inden-5-yl-(3-iodophenyl)methanol |
|---|---|
| PubChem CID | 61088523 |
| Molecular Formula | C16H15IO |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl-(3-iodophenyl)methanol |
| SMILES | OC(c1cccc(I)c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H15IO/c17-15-6-2-5-13(10-15)16(18)14-8-7-11-3-1-4-12(11)9-14/h2,5-10,16,18H,1,3-4H2 |
| InChIKey | CUBXLYSNDDXBIV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|