C17H18IN — CID 43124478
N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-3-iodoaniline (PubChem CID 43124478) has the molecular formula C17H18IN and a molecular weight of 363.24 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-3-iodoaniline.
| Compound Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-3-iodoaniline |
|---|---|
| PubChem CID | 43124478 |
| Molecular Formula | C17H18IN |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-3-iodoaniline |
| SMILES | CC(Nc1cccc(I)c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H18IN/c1-12(19-17-7-3-6-16(18)11-17)14-9-8-13-4-2-5-15(13)10-14/h3,6-12,19H,2,4-5H2,1H3 |
| InChIKey | UTUWYNWNRPIQHM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|