C18H19ClIN — CID 63445713
2-chloro-4-iodo-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]aniline (PubChem CID 63445713) has the molecular formula C18H19ClIN and a molecular weight of 411.71 g/mol. Its IUPAC name is 2-chloro-4-iodo-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]aniline.
| Compound Name | 2-chloro-4-iodo-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 63445713 |
| Molecular Formula | C18H19ClIN |
| Molecular Weight | 411.71 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 2-chloro-4-iodo-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]aniline |
| SMILES | CC(Nc1ccc(I)cc1Cl)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H19ClIN/c1-12(21-18-9-8-16(20)11-17(18)19)14-7-6-13-4-2-3-5-15(13)10-14/h6-12,21H,2-5H2,1H3 |
| InChIKey | URTMJXIBRDFNBE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.71 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|