C17H16Cl2FN — CID 107572608
3,5-dichloro-N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-fluoroaniline (PubChem CID 107572608) has the molecular formula C17H16Cl2FN and a molecular weight of 324.23 g/mol. Its IUPAC name is 3,5-dichloro-N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-fluoroaniline.
| Compound Name | 3,5-dichloro-N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 107572608 |
| Molecular Formula | C17H16Cl2FN |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3,5-dichloro-N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-fluoroaniline |
| SMILES | CC(Nc1cc(Cl)c(F)c(Cl)c1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H16Cl2FN/c1-10(12-6-5-11-3-2-4-13(11)7-12)21-14-8-15(18)17(20)16(19)9-14/h5-10,21H,2-4H2,1H3 |
| InChIKey | JGTRALCCAQQYJT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|