C14H10BrCl2F2N — CID 107572700
N-[1-(3-bromo-4-fluorophenyl)ethyl]-3,5-dichloro-4-fluoroaniline (PubChem CID 107572700) has the molecular formula C14H10BrCl2F2N and a molecular weight of 381.05 g/mol. Its IUPAC name is N-[1-(3-bromo-4-fluorophenyl)ethyl]-3,5-dichloro-4-fluoroaniline.
| Compound Name | N-[1-(3-bromo-4-fluorophenyl)ethyl]-3,5-dichloro-4-fluoroaniline |
|---|---|
| PubChem CID | 107572700 |
| Molecular Formula | C14H10BrCl2F2N |
| Molecular Weight | 381.05 g/mol |
| Exact Mass | 378.93 |
| IUPAC Name | N-[1-(3-bromo-4-fluorophenyl)ethyl]-3,5-dichloro-4-fluoroaniline |
| SMILES | CC(Nc1cc(Cl)c(F)c(Cl)c1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H10BrCl2F2N/c1-7(8-2-3-13(18)10(15)4-8)20-9-5-11(16)14(19)12(17)6-9/h2-7,20H,1H3 |
| InChIKey | UWCWCUORELRNNU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.05 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|