C16H18BrFN2 — CID 43778749
1-N-[1-(3-bromo-4-fluorophenyl)ethyl]-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 43778749) has the molecular formula C16H18BrFN2 and a molecular weight of 337.24 g/mol. Its IUPAC name is 1-N-[1-(3-bromo-4-fluorophenyl)ethyl]-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[1-(3-bromo-4-fluorophenyl)ethyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 43778749 |
| Molecular Formula | C16H18BrFN2 |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1-N-[1-(3-bromo-4-fluorophenyl)ethyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CC(Nc1ccc(N(C)C)cc1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C16H18BrFN2/c1-11(12-4-9-16(18)15(17)10-12)19-13-5-7-14(8-6-13)20(2)3/h4-11,19H,1-3H3 |
| InChIKey | UAYAGOFOKWKPIC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|