C15H17NS — CID 66352791
N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]thiophen-3-amine (PubChem CID 66352791) has the molecular formula C15H17NS and a molecular weight of 243.38 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]thiophen-3-amine.
| Compound Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66352791 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]thiophen-3-amine |
| SMILES | CC(Nc1ccsc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H17NS/c1-11(16-15-7-8-17-10-15)13-6-5-12-3-2-4-14(12)9-13/h5-11,16H,2-4H2,1H3 |
| InChIKey | HSICAVROFFLHJR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |