C13H15N3S — CID 107649398
N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]thiadiazol-5-amine (PubChem CID 107649398) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]thiadiazol-5-amine.
| Compound Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]thiadiazol-5-amine |
|---|---|
| PubChem CID | 107649398 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]thiadiazol-5-amine |
| SMILES | CC(Nc1cnns1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H15N3S/c1-9(15-13-8-14-16-17-13)11-6-5-10-3-2-4-12(10)7-11/h5-9,15H,2-4H2,1H3 |
| InChIKey | FEQJMGCEFLPPLH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |