C15H19NO3S — CID 66351198
N-[1-(3,4,5-trimethoxyphenyl)ethyl]thiophen-3-amine (PubChem CID 66351198) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-[1-(3,4,5-trimethoxyphenyl)ethyl]thiophen-3-amine.
| Compound Name | N-[1-(3,4,5-trimethoxyphenyl)ethyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66351198 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-[1-(3,4,5-trimethoxyphenyl)ethyl]thiophen-3-amine |
| SMILES | COc1cc(C(C)Nc2ccsc2)cc(OC)c1OC |
| InChI | InChI=1S/C15H19NO3S/c1-10(16-12-5-6-20-9-12)11-7-13(17-2)15(19-4)14(8-11)18-3/h5-10,16H,1-4H3 |
| InChIKey | SXOPVDDAGYODFB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |