C13H21NO4 — CID 82710078
N-ethoxy-1-(3,4,5-trimethoxyphenyl)ethanamine (PubChem CID 82710078) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is N-ethoxy-1-(3,4,5-trimethoxyphenyl)ethanamine.
| Compound Name | N-ethoxy-1-(3,4,5-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 82710078 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-ethoxy-1-(3,4,5-trimethoxyphenyl)ethanamine |
| SMILES | CCONC(C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H21NO4/c1-6-18-14-9(2)10-7-11(15-3)13(17-5)12(8-10)16-4/h7-9,14H,6H2,1-5H3 |
| InChIKey | JEODXLPBESODOF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|