C19H25NO4 — CID 119126875
N-[(4-methoxyphenyl)methyl]-1-(3,4,5-trimethoxyphenyl)ethanamine (PubChem CID 119126875) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-1-(3,4,5-trimethoxyphenyl)ethanamine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-1-(3,4,5-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 119126875 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-1-(3,4,5-trimethoxyphenyl)ethanamine |
| SMILES | COc1ccc(CNC(C)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H25NO4/c1-13(20-12-14-6-8-16(21-2)9-7-14)15-10-17(22-3)19(24-5)18(11-15)23-4/h6-11,13,20H,12H2,1-5H3 |
| InChIKey | XEOPAEYEOJLFIN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |