C16H21NO3S — CID 63002073
N-(thiophen-3-ylmethyl)-1-(3,4,5-trimethoxyphenyl)ethanamine (PubChem CID 63002073) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is N-(thiophen-3-ylmethyl)-1-(3,4,5-trimethoxyphenyl)ethanamine.
| Compound Name | N-(thiophen-3-ylmethyl)-1-(3,4,5-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 63002073 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-(thiophen-3-ylmethyl)-1-(3,4,5-trimethoxyphenyl)ethanamine |
| SMILES | COc1cc(C(C)NCc2ccsc2)cc(OC)c1OC |
| InChI | InChI=1S/C16H21NO3S/c1-11(17-9-12-5-6-21-10-12)13-7-14(18-2)16(20-4)15(8-13)19-3/h5-8,10-11,17H,9H2,1-4H3 |
| InChIKey | IXFVGROUSMXQNE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |