C14H19NO3 — CID 43363384
N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-yn-1-amine (PubChem CID 43363384) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-yn-1-amine.
| Compound Name | N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 43363384 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-yn-1-amine |
| SMILES | C#CCNC(C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H19NO3/c1-6-7-15-10(2)11-8-12(16-3)14(18-5)13(9-11)17-4/h1,8-10,15H,7H2,2-5H3 |
| InChIKey | HMWFOIIYGWUYQK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|