C17H29NO3 — CID 64568461
2,3-dimethyl-N-[1-(3,4,5-trimethoxyphenyl)ethyl]butan-1-amine (PubChem CID 64568461) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is 2,3-dimethyl-N-[1-(3,4,5-trimethoxyphenyl)ethyl]butan-1-amine.
| Compound Name | 2,3-dimethyl-N-[1-(3,4,5-trimethoxyphenyl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 64568461 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2,3-dimethyl-N-[1-(3,4,5-trimethoxyphenyl)ethyl]butan-1-amine |
| SMILES | COc1cc(C(C)NCC(C)C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C17H29NO3/c1-11(2)12(3)10-18-13(4)14-8-15(19-5)17(21-7)16(9-14)20-6/h8-9,11-13,18H,10H2,1-7H3 |
| InChIKey | UTCGMVWSSPSSHU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |