C15H25NO4 — CID 82711410
N-(2-methylpropoxy)-1-(3,4,5-trimethoxyphenyl)ethanamine (PubChem CID 82711410) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is N-(2-methylpropoxy)-1-(3,4,5-trimethoxyphenyl)ethanamine.
| Compound Name | N-(2-methylpropoxy)-1-(3,4,5-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 82711410 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N-(2-methylpropoxy)-1-(3,4,5-trimethoxyphenyl)ethanamine |
| SMILES | COc1cc(C(C)NOCC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C15H25NO4/c1-10(2)9-20-16-11(3)12-7-13(17-4)15(19-6)14(8-12)18-5/h7-8,10-11,16H,9H2,1-6H3 |
| InChIKey | XLAHNDMFWHMQIZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|