C12H14F2 — CID 164603454
5-(difluoromethyl)-2,3-dihydro-1H-indene;ethene (PubChem CID 164603454) has the molecular formula C12H14F2 and a molecular weight of 196.24 g/mol. Its IUPAC name is 5-(difluoromethyl)-2,3-dihydro-1H-indene;ethene.
| Compound Name | 5-(difluoromethyl)-2,3-dihydro-1H-indene;ethene |
|---|---|
| PubChem CID | 164603454 |
| Molecular Formula | C12H14F2 |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 5-(difluoromethyl)-2,3-dihydro-1H-indene;ethene |
| SMILES | C=C.FC(F)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H10F2.C2H4/c11-10(12)9-5-4-7-2-1-3-8(7)6-9;1-2/h4-6,10H,1-3H2;1-2H2 |
| InChIKey | NRTJMNIBNMHPOJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|