C12H16FN — CID 130479547
3-(2,3-dihydro-1H-inden-5-yl)-3-fluoropropan-1-amine (PubChem CID 130479547) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-yl)-3-fluoropropan-1-amine.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-yl)-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 130479547 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-yl)-3-fluoropropan-1-amine |
| SMILES | NCCC(F)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H16FN/c13-12(6-7-14)11-5-4-9-2-1-3-10(9)8-11/h4-5,8,12H,1-3,6-7,14H2 |
| InChIKey | XTLYSFKDEMNIOZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |