C12H16N2 — CID 144541952
(methylideneamino)-(5,6,7,8-tetrahydronaphthalen-2-yl)methanamine (PubChem CID 144541952) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (methylideneamino)-(5,6,7,8-tetrahydronaphthalen-2-yl)methanamine.
| Compound Name | (methylideneamino)-(5,6,7,8-tetrahydronaphthalen-2-yl)methanamine |
|---|---|
| PubChem CID | 144541952 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (methylideneamino)-(5,6,7,8-tetrahydronaphthalen-2-yl)methanamine |
| SMILES | C=NC(N)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C12H16N2/c1-14-12(13)11-7-6-9-4-2-3-5-10(9)8-11/h6-8,12H,1-5,13H2 |
| InChIKey | JECZZUXIFHYPTD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|