C11H15NO2 — CID 96752946
(1R)-2-amino-1-(3,4-dihydro-1H-isochromen-6-yl)ethanol (PubChem CID 96752946) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (1R)-2-amino-1-(3,4-dihydro-1H-isochromen-6-yl)ethanol.
| Compound Name | (1R)-2-amino-1-(3,4-dihydro-1H-isochromen-6-yl)ethanol |
|---|---|
| PubChem CID | 96752946 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (1R)-2-amino-1-(3,4-dihydro-1H-isochromen-6-yl)ethanol |
| SMILES | NC[C@H](O)c1ccc2c(c1)CCOC2 |
| InChI | InChI=1S/C11H15NO2/c12-6-11(13)9-1-2-10-7-14-4-3-8(10)5-9/h1-2,5,11,13H,3-4,6-7,12H2/t11-/m0/s1 |
| InChIKey | ORAZSTGMPSJYBU-NSHDSACASA-N |
| XLogP | 0.75 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |