C16H14Br2O — CID 63444189
6-[bromo-(4-bromophenyl)methyl]-3,4-dihydro-2H-chromene (PubChem CID 63444189) has the molecular formula C16H14Br2O and a molecular weight of 382.10 g/mol. Its IUPAC name is 6-[bromo-(4-bromophenyl)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[bromo-(4-bromophenyl)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 63444189 |
| Molecular Formula | C16H14Br2O |
| Molecular Weight | 382.10 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | 6-[bromo-(4-bromophenyl)methyl]-3,4-dihydro-2H-chromene |
| SMILES | Brc1ccc(C(Br)c2ccc3c(c2)CCCO3)cc1 |
| InChI | InChI=1S/C16H14Br2O/c17-14-6-3-11(4-7-14)16(18)13-5-8-15-12(10-13)2-1-9-19-15/h3-8,10,16H,1-2,9H2 |
| InChIKey | GUJMQJWLNOLBOT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.10 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|