C16H13BrCl2O — CID 107957741
6-[(3-bromo-5-chlorophenyl)-chloromethyl]-3,4-dihydro-2H-chromene (PubChem CID 107957741) has the molecular formula C16H13BrCl2O and a molecular weight of 372.09 g/mol. Its IUPAC name is 6-[(3-bromo-5-chlorophenyl)-chloromethyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[(3-bromo-5-chlorophenyl)-chloromethyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 107957741 |
| Molecular Formula | C16H13BrCl2O |
| Molecular Weight | 372.09 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | 6-[(3-bromo-5-chlorophenyl)-chloromethyl]-3,4-dihydro-2H-chromene |
| SMILES | Clc1cc(Br)cc(C(Cl)c2ccc3c(c2)CCCO3)c1 |
| InChI | InChI=1S/C16H13BrCl2O/c17-13-7-12(8-14(18)9-13)16(19)11-3-4-15-10(6-11)2-1-5-20-15/h3-4,6-9,16H,1-2,5H2 |
| InChIKey | FJZSWYZIXORXPG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.09 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|