C14H13ClOS — CID 61084871
6-[chloro(thiophen-3-yl)methyl]-3,4-dihydro-2H-chromene (PubChem CID 61084871) has the molecular formula C14H13ClOS and a molecular weight of 264.78 g/mol. Its IUPAC name is 6-[chloro(thiophen-3-yl)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[chloro(thiophen-3-yl)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 61084871 |
| Molecular Formula | C14H13ClOS |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 6-[chloro(thiophen-3-yl)methyl]-3,4-dihydro-2H-chromene |
| SMILES | ClC(c1ccsc1)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C14H13ClOS/c15-14(12-5-7-17-9-12)11-3-4-13-10(8-11)2-1-6-16-13/h3-5,7-9,14H,1-2,6H2 |
| InChIKey | HDJBTURFHWAMBX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|