C19H21ClO — CID 63435187
6-[chloro-(2,4,6-trimethylphenyl)methyl]-3,4-dihydro-2H-chromene (PubChem CID 63435187) has the molecular formula C19H21ClO and a molecular weight of 300.83 g/mol. Its IUPAC name is 6-[chloro-(2,4,6-trimethylphenyl)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[chloro-(2,4,6-trimethylphenyl)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 63435187 |
| Molecular Formula | C19H21ClO |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 6-[chloro-(2,4,6-trimethylphenyl)methyl]-3,4-dihydro-2H-chromene |
| SMILES | Cc1cc(C)c(C(Cl)c2ccc3c(c2)CCCO3)c(C)c1 |
| InChI | InChI=1S/C19H21ClO/c1-12-9-13(2)18(14(3)10-12)19(20)16-6-7-17-15(11-16)5-4-8-21-17/h6-7,9-11,19H,4-5,8H2,1-3H3 |
| InChIKey | UJQNNJPKGZYLSF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|