C18H19ClO2 — CID 63435190
6-[chloro-(2-methoxy-5-methylphenyl)methyl]-3,4-dihydro-2H-chromene (PubChem CID 63435190) has the molecular formula C18H19ClO2 and a molecular weight of 302.80 g/mol. Its IUPAC name is 6-[chloro-(2-methoxy-5-methylphenyl)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[chloro-(2-methoxy-5-methylphenyl)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 63435190 |
| Molecular Formula | C18H19ClO2 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 6-[chloro-(2-methoxy-5-methylphenyl)methyl]-3,4-dihydro-2H-chromene |
| SMILES | COc1ccc(C)cc1C(Cl)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C18H19ClO2/c1-12-5-7-17(20-2)15(10-12)18(19)14-6-8-16-13(11-14)4-3-9-21-16/h5-8,10-11,18H,3-4,9H2,1-2H3 |
| InChIKey | ISRPPLKLSGKGGR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|