C20H24O2 — CID 145129554
6-[1-(3-ethyl-4-methoxyphenyl)ethyl]-3,4-dihydro-2H-chromene (PubChem CID 145129554) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 6-[1-(3-ethyl-4-methoxyphenyl)ethyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[1-(3-ethyl-4-methoxyphenyl)ethyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 145129554 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 6-[1-(3-ethyl-4-methoxyphenyl)ethyl]-3,4-dihydro-2H-chromene |
| SMILES | CCc1cc(C(C)c2ccc3c(c2)CCCO3)ccc1OC |
| InChI | InChI=1S/C20H24O2/c1-4-15-12-16(7-9-19(15)21-3)14(2)17-8-10-20-18(13-17)6-5-11-22-20/h7-10,12-14H,4-6,11H2,1-3H3 |
| InChIKey | SBPDQEVLKACQOW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |