C17H17ClO2 — CID 61085686
6-[chloro-(4-methoxyphenyl)methyl]-3,4-dihydro-2H-chromene (PubChem CID 61085686) has the molecular formula C17H17ClO2 and a molecular weight of 288.77 g/mol. Its IUPAC name is 6-[chloro-(4-methoxyphenyl)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[chloro-(4-methoxyphenyl)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 61085686 |
| Molecular Formula | C17H17ClO2 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 6-[chloro-(4-methoxyphenyl)methyl]-3,4-dihydro-2H-chromene |
| SMILES | COc1ccc(C(Cl)c2ccc3c(c2)CCCO3)cc1 |
| InChI | InChI=1S/C17H17ClO2/c1-19-15-7-4-12(5-8-15)17(18)14-6-9-16-13(11-14)3-2-10-20-16/h4-9,11,17H,2-3,10H2,1H3 |
| InChIKey | KISXMNLPHCGUCV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|