C17H17ClO — CID 63429922
5-[chloro-(2,4-dimethylphenyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 63429922) has the molecular formula C17H17ClO and a molecular weight of 272.77 g/mol. Its IUPAC name is 5-[chloro-(2,4-dimethylphenyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[chloro-(2,4-dimethylphenyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 63429922 |
| Molecular Formula | C17H17ClO |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 5-[chloro-(2,4-dimethylphenyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Cc1ccc(C(Cl)c2ccc3c(c2)CCO3)c(C)c1 |
| InChI | InChI=1S/C17H17ClO/c1-11-3-5-15(12(2)9-11)17(18)14-4-6-16-13(10-14)7-8-19-16/h3-6,9-10,17H,7-8H2,1-2H3 |
| InChIKey | CDULHQZMACASDR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|