C16H14ClFO — CID 61085337
5-[chloro-(3-fluoro-4-methylphenyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 61085337) has the molecular formula C16H14ClFO and a molecular weight of 276.74 g/mol. Its IUPAC name is 5-[chloro-(3-fluoro-4-methylphenyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[chloro-(3-fluoro-4-methylphenyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 61085337 |
| Molecular Formula | C16H14ClFO |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-[chloro-(3-fluoro-4-methylphenyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Cc1ccc(C(Cl)c2ccc3c(c2)CCO3)cc1F |
| InChI | InChI=1S/C16H14ClFO/c1-10-2-3-13(9-14(10)18)16(17)12-4-5-15-11(8-12)6-7-19-15/h2-5,8-9,16H,6-7H2,1H3 |
| InChIKey | ZDTFRPMGYNYPND-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|