C15H11Cl3O — CID 63430264
5-[chloro-(2,3-dichlorophenyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 63430264) has the molecular formula C15H11Cl3O and a molecular weight of 313.61 g/mol. Its IUPAC name is 5-[chloro-(2,3-dichlorophenyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[chloro-(2,3-dichlorophenyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 63430264 |
| Molecular Formula | C15H11Cl3O |
| Molecular Weight | 313.61 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 5-[chloro-(2,3-dichlorophenyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Clc1cccc(C(Cl)c2ccc3c(c2)CCO3)c1Cl |
| InChI | InChI=1S/C15H11Cl3O/c16-12-3-1-2-11(15(12)18)14(17)10-4-5-13-9(8-10)6-7-19-13/h1-5,8,14H,6-7H2 |
| InChIKey | QHJBUMVAFTYXMZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|