C16H13Cl3O2 — CID 63429460
7-[chloro-(2,3-dichlorophenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 63429460) has the molecular formula C16H13Cl3O2 and a molecular weight of 343.64 g/mol. Its IUPAC name is 7-[chloro-(2,3-dichlorophenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-[chloro-(2,3-dichlorophenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 63429460 |
| Molecular Formula | C16H13Cl3O2 |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 7-[chloro-(2,3-dichlorophenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | Clc1cccc(C(Cl)c2ccc3c(c2)OCCCO3)c1Cl |
| InChI | InChI=1S/C16H13Cl3O2/c17-12-4-1-3-11(16(12)19)15(18)10-5-6-13-14(9-10)21-8-2-7-20-13/h1,3-6,9,15H,2,7-8H2 |
| InChIKey | VXIQMTDVRMYMKM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|