C16H15Cl2NO — CID 61026960
(2,3-dichlorophenyl)-(3,4-dihydro-2H-chromen-6-yl)methanamine (PubChem CID 61026960) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-(3,4-dihydro-2H-chromen-6-yl)methanamine.
| Compound Name | (2,3-dichlorophenyl)-(3,4-dihydro-2H-chromen-6-yl)methanamine |
|---|---|
| PubChem CID | 61026960 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | (2,3-dichlorophenyl)-(3,4-dihydro-2H-chromen-6-yl)methanamine |
| SMILES | NC(c1ccc2c(c1)CCCO2)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H15Cl2NO/c17-13-5-1-4-12(15(13)18)16(19)11-6-7-14-10(9-11)3-2-8-20-14/h1,4-7,9,16H,2-3,8,19H2 |
| InChIKey | YPFGEKIZTLXDSL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |