C19H21ClO — CID 63444363
5-[chloro-(2-ethoxy-5-methylphenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 63444363) has the molecular formula C19H21ClO and a molecular weight of 300.83 g/mol. Its IUPAC name is 5-[chloro-(2-ethoxy-5-methylphenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[chloro-(2-ethoxy-5-methylphenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 63444363 |
| Molecular Formula | C19H21ClO |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-[chloro-(2-ethoxy-5-methylphenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | CCOc1ccc(C)cc1C(Cl)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H21ClO/c1-3-21-18-10-7-13(2)11-17(18)19(20)16-9-8-14-5-4-6-15(14)12-16/h7-12,19H,3-6H2,1-2H3 |
| InChIKey | CXMCCNJEDQLCTJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|