C12H15Cl — CID 61086419
5-(1-chloropropyl)-2,3-dihydro-1H-indene (PubChem CID 61086419) has the molecular formula C12H15Cl and a molecular weight of 194.70 g/mol. Its IUPAC name is 5-(1-chloropropyl)-2,3-dihydro-1H-indene.
| Compound Name | 5-(1-chloropropyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 61086419 |
| Molecular Formula | C12H15Cl |
| Molecular Weight | 194.70 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-(1-chloropropyl)-2,3-dihydro-1H-indene |
| SMILES | CCC(Cl)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H15Cl/c1-2-12(13)11-7-6-9-4-3-5-10(9)8-11/h6-8,12H,2-5H2,1H3 |
| InChIKey | XXRPNVHYPKFBNT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.70 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|