C15H21Br — CID 114876125
5-(1-bromo-3-methylpentyl)-2,3-dihydro-1H-indene (PubChem CID 114876125) has the molecular formula C15H21Br and a molecular weight of 281.24 g/mol. Its IUPAC name is 5-(1-bromo-3-methylpentyl)-2,3-dihydro-1H-indene.
| Compound Name | 5-(1-bromo-3-methylpentyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 114876125 |
| Molecular Formula | C15H21Br |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 5-(1-bromo-3-methylpentyl)-2,3-dihydro-1H-indene |
| SMILES | CCC(C)CC(Br)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H21Br/c1-3-11(2)9-15(16)14-8-7-12-5-4-6-13(12)10-14/h7-8,10-11,15H,3-6,9H2,1-2H3 |
| InChIKey | SKIYOCSDOXYTMT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|