C15H21Br — CID 63439172
6-(1-bromo-2,2-dimethylpropyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 63439172) has the molecular formula C15H21Br and a molecular weight of 281.24 g/mol. Its IUPAC name is 6-(1-bromo-2,2-dimethylpropyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-(1-bromo-2,2-dimethylpropyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63439172 |
| Molecular Formula | C15H21Br |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 6-(1-bromo-2,2-dimethylpropyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)(C)C(Br)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C15H21Br/c1-15(2,3)14(16)13-9-8-11-6-4-5-7-12(11)10-13/h8-10,14H,4-7H2,1-3H3 |
| InChIKey | REQOERNXQFLUPZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|