C20H23Cl — CID 63430990
6-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 63430990) has the molecular formula C20H23Cl and a molecular weight of 298.86 g/mol. Its IUPAC name is 6-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63430990 |
| Molecular Formula | C20H23Cl |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 6-[1-chloro-2-(2,5-dimethylphenyl)ethyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1ccc(C)c(CC(Cl)c2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C20H23Cl/c1-14-7-8-15(2)19(11-14)13-20(21)18-10-9-16-5-3-4-6-17(16)12-18/h7-12,20H,3-6,13H2,1-2H3 |
| InChIKey | ICORDEFRUUXYOS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|