C20H23Cl — CID 115482816
5-[chloro-(3,4-diethylphenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 115482816) has the molecular formula C20H23Cl and a molecular weight of 298.86 g/mol. Its IUPAC name is 5-[chloro-(3,4-diethylphenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[chloro-(3,4-diethylphenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 115482816 |
| Molecular Formula | C20H23Cl |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 5-[chloro-(3,4-diethylphenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | CCc1ccc(C(Cl)c2ccc3c(c2)CCC3)cc1CC |
| InChI | InChI=1S/C20H23Cl/c1-3-14-8-10-18(12-15(14)4-2)20(21)19-11-9-16-6-5-7-17(16)13-19/h8-13,20H,3-7H2,1-2H3 |
| InChIKey | OMDORLHJHMFVOM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|