C17H17ClF2 — CID 115482894
1-[chloro-(3,4-diethylphenyl)methyl]-3,5-difluorobenzene (PubChem CID 115482894) has the molecular formula C17H17ClF2 and a molecular weight of 294.77 g/mol. Its IUPAC name is 1-[chloro-(3,4-diethylphenyl)methyl]-3,5-difluorobenzene.
| Compound Name | 1-[chloro-(3,4-diethylphenyl)methyl]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 115482894 |
| Molecular Formula | C17H17ClF2 |
| Molecular Weight | 294.77 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-[chloro-(3,4-diethylphenyl)methyl]-3,5-difluorobenzene |
| SMILES | CCc1ccc(C(Cl)c2cc(F)cc(F)c2)cc1CC |
| InChI | InChI=1S/C17H17ClF2/c1-3-11-5-6-13(7-12(11)4-2)17(18)14-8-15(19)10-16(20)9-14/h5-10,17H,3-4H2,1-2H3 |
| InChIKey | VEEJNXUTHLQXHM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.77 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|