C18H20ClF — CID 115482844
1-[chloro-(3,4-diethylphenyl)methyl]-2-fluoro-4-methylbenzene (PubChem CID 115482844) has the molecular formula C18H20ClF and a molecular weight of 290.81 g/mol. Its IUPAC name is 1-[chloro-(3,4-diethylphenyl)methyl]-2-fluoro-4-methylbenzene.
| Compound Name | 1-[chloro-(3,4-diethylphenyl)methyl]-2-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 115482844 |
| Molecular Formula | C18H20ClF |
| Molecular Weight | 290.81 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[chloro-(3,4-diethylphenyl)methyl]-2-fluoro-4-methylbenzene |
| SMILES | CCc1ccc(C(Cl)c2ccc(C)cc2F)cc1CC |
| InChI | InChI=1S/C18H20ClF/c1-4-13-7-8-15(11-14(13)5-2)18(19)16-9-6-12(3)10-17(16)20/h6-11,18H,4-5H2,1-3H3 |
| InChIKey | NSFFABJLJZSDMC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.81 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|