C17H17Cl2F — CID 115482870
1-chloro-3-[chloro-(3,4-diethylphenyl)methyl]-2-fluorobenzene (PubChem CID 115482870) has the molecular formula C17H17Cl2F and a molecular weight of 311.23 g/mol. Its IUPAC name is 1-chloro-3-[chloro-(3,4-diethylphenyl)methyl]-2-fluorobenzene.
| Compound Name | 1-chloro-3-[chloro-(3,4-diethylphenyl)methyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 115482870 |
| Molecular Formula | C17H17Cl2F |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1-chloro-3-[chloro-(3,4-diethylphenyl)methyl]-2-fluorobenzene |
| SMILES | CCc1ccc(C(Cl)c2cccc(Cl)c2F)cc1CC |
| InChI | InChI=1S/C17H17Cl2F/c1-3-11-8-9-13(10-12(11)4-2)16(19)14-6-5-7-15(18)17(14)20/h5-10,16H,3-4H2,1-2H3 |
| InChIKey | QCCVZPSDAPLELZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|