About 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene
4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene (PubChem CID 115483069) has the molecular formula C18H21BrS
and a molecular weight of 349.34 g/mol. Its IUPAC name is 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene.
Molecular Properties
| Compound Name | 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene |
| PubChem CID | 115483069 |
| Molecular Formula | C18H21BrS |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene |
| SMILES | CCc1ccc(C(Br)c2ccccc2SC)cc1CC |
| InChI | InChI=1S/C18H21BrS/c1-4-13-10-11-15(12-14(13)5-2)18(19)16-8-6-7-9-17(16)20-3/h6-12,18H,4-5H2,1-3H3 |
| InChIKey | FFWRYQGJFJQKOD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene?
The IUPAC name of 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene (CID 115483069) is 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene.
What is the SMILES notation for 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene?
The canonical SMILES for 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene is CCc1ccc(C(Br)c2ccccc2SC)cc1CC.
What is the InChIKey of 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene?
The InChIKey is FFWRYQGJFJQKOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21BrS/c1-4-13-10-11-15(12-14(13)5-2)18(19)16-8-6-7-9-17(16)20-3/h6-12,18H,4-5H2,1-3H3.
What are the key properties of 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene?
4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene has a molecular weight of 349.34 g/mol, XLogP of 6.02, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-diethylbenzene is sourced from PubChem (CID 115483069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).