C16H17BrS — CID 79217999
4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-dimethylbenzene (PubChem CID 79217999) has the molecular formula C16H17BrS and a molecular weight of 321.28 g/mol. Its IUPAC name is 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-dimethylbenzene.
| Compound Name | 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 79217999 |
| Molecular Formula | C16H17BrS |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-[bromo-(2-methylsulfanylphenyl)methyl]-1,2-dimethylbenzene |
| SMILES | CSc1ccccc1C(Br)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H17BrS/c1-11-8-9-13(10-12(11)2)16(17)14-6-4-5-7-15(14)18-3/h4-10,16H,1-3H3 |
| InChIKey | AJWKHGNPSKOKPI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|