C19H17Br — CID 63435816
1-[bromo-(3,4-dimethylphenyl)methyl]naphthalene (PubChem CID 63435816) has the molecular formula C19H17Br and a molecular weight of 325.25 g/mol. Its IUPAC name is 1-[bromo-(3,4-dimethylphenyl)methyl]naphthalene.
| Compound Name | 1-[bromo-(3,4-dimethylphenyl)methyl]naphthalene |
|---|---|
| PubChem CID | 63435816 |
| Molecular Formula | C19H17Br |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1-[bromo-(3,4-dimethylphenyl)methyl]naphthalene |
| SMILES | Cc1ccc(C(Br)c2cccc3ccccc23)cc1C |
| InChI | InChI=1S/C19H17Br/c1-13-10-11-16(12-14(13)2)19(20)18-9-5-7-15-6-3-4-8-17(15)18/h3-12,19H,1-2H3 |
| InChIKey | FDRLUWCXKDQOQV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|