C17H11BrCl2 — CID 63444748
1-[bromo-(3,4-dichlorophenyl)methyl]naphthalene (PubChem CID 63444748) has the molecular formula C17H11BrCl2 and a molecular weight of 366.09 g/mol. Its IUPAC name is 1-[bromo-(3,4-dichlorophenyl)methyl]naphthalene.
| Compound Name | 1-[bromo-(3,4-dichlorophenyl)methyl]naphthalene |
|---|---|
| PubChem CID | 63444748 |
| Molecular Formula | C17H11BrCl2 |
| Molecular Weight | 366.09 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | 1-[bromo-(3,4-dichlorophenyl)methyl]naphthalene |
| SMILES | Clc1ccc(C(Br)c2cccc3ccccc23)cc1Cl |
| InChI | InChI=1S/C17H11BrCl2/c18-17(12-8-9-15(19)16(20)10-12)14-7-3-5-11-4-1-2-6-13(11)14/h1-10,17H |
| InChIKey | RRJUODRSMCPHLR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.09 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|