C17H10BrClF2 — CID 82772676
1-[bromo-(4-chloro-2,5-difluorophenyl)methyl]naphthalene (PubChem CID 82772676) has the molecular formula C17H10BrClF2 and a molecular weight of 367.62 g/mol. Its IUPAC name is 1-[bromo-(4-chloro-2,5-difluorophenyl)methyl]naphthalene.
| Compound Name | 1-[bromo-(4-chloro-2,5-difluorophenyl)methyl]naphthalene |
|---|---|
| PubChem CID | 82772676 |
| Molecular Formula | C17H10BrClF2 |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 1-[bromo-(4-chloro-2,5-difluorophenyl)methyl]naphthalene |
| SMILES | Fc1cc(C(Br)c2cccc3ccccc23)c(F)cc1Cl |
| InChI | InChI=1S/C17H10BrClF2/c18-17(13-8-16(21)14(19)9-15(13)20)12-7-3-5-10-4-1-2-6-11(10)12/h1-9,17H |
| InChIKey | KPVSLHGELUTHHC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|